ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-메틸-3-페닐-4-이소옥사졸릴 이소티오시아네이트 |
|
| 상품명칭 | 5-메틸-3-페닐-4-이소옥사졸릴 이소티오시아네이트 |
| 별명 | 4-이소티오시아나토-5-메틸-3-페닐이소옥사졸; |
| 영문 이름 | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| 분자식 | C11H8N2OS |
| 분자량 | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| cas번호 | 306934-97-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.22g/cm3 |
| 녹는 점 | 65℃ |
| 비등점 | 397.9°C at 760 mmHg |
| 굴절 지수 | 1.63 |
| 인화점 | 194.4°C |
| 증기압 | 3.52E-06mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |