ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 izotiocyjanian 5-metylo-3-fenylo-4-izoksazolilu |
|
Nazwa produktu: | izotiocyjanian 5-metylo-3-fenylo-4-izoksazolilu |
Synonimy | 4-izotiocyjanato-5-metylo-3-fenylosoksazol; |
Angielska nazwa | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
MF | C11H8N2OS |
Masie cząsteczkowej | 216.259 |
InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
Nr CAS | 306934-97-4 |
Struktury molekularnej | ![]() |
Gęstość | 1.22g/cm3 |
Temperatura topnienia | 65℃ |
Temperatura wrzenia | 397.9°C at 760 mmHg |
Współczynnik załamania | 1.63 |
Temperatura zapłonu | 194.4°C |
Ciśnienie pary | 3.52E-06mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |