Chemindex > 306934-97-4
NO ▼
306934-97-4 5-metyl-3-fenyl-4-isoksazolylisotiocyanat |
|
| produktnavn | 5-metyl-3-fenyl-4-isoksazolylisotiocyanat |
| Synonymer | 4-isotiocyanato-5-metyl-3-fenylisoksazol; |
| Engelsk navn | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| Molekylær Formel | C11H8N2OS |
| Molekylvekt | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| CAS-nummer | 306934-97-4 |
| Molecular Structure |  |
| Tetthet | 1.22g/cm3 |
| Smeltepunkt | 65℃ |
| Kokepunkt | 397.9°C at 760 mmHg |
| Brytningsindeks | 1.63 |
| Flammepunktet | 194.4°C |
| Damptrykk | 3.52E-06mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 306934-97-4 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 