ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-मिथाइल-3-फिनाइल-4-आइसोक्साज़ोलिल आइसोथियोसाइनेट |
|
उत्पाद का नाम | 5-मिथाइल-3-फिनाइल-4-आइसोक्साज़ोलिल आइसोथियोसाइनेट |
समानार्थी | 4-isothiocyanato-5-मिथाइल-3-phenylisoxazole; |
अंग्रेज | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
आणविक फार्मूला | C11H8N2OS |
आण्विक वजन | 216.259 |
InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
कैस रजिस्टी संख्या | 306934-97-4 |
आणविक संरचना | ![]() |
घनत्व | 1.22g/cm3 |
गलनांक | 65℃ |
उबलने का समय | 397.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.63 |
फ्लैश प्वाइंट | 194.4°C |
वाष्प का दबाव | 3.52E-06mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |