ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-97-4 5-metil-3-fenil-4-izoksazolil izotiyosiyanat |
|
| Ürün Adı | 5-metil-3-fenil-4-izoksazolil izotiyosiyanat |
| Eş anlamlı | 4-izotiyosiyanot-5-metil-3-fenilikosazol; |
| ingilizce adı | 5-methyl-3-phenyl-4-isoxazolyl isothiocyanate;4-isothiocyanato-5-methyl-3-phenylisoxazole |
| Moleküler Formülü | C11H8N2OS |
| Molekül Ağırlığı | 216.259 |
| InChI | InChI=1/C11H8N2OS/c1-8-10(12-7-15)11(13-14-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| CAS kayıt numarası | 306934-97-4 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.22g/cm3 |
| Ergime noktası | 65℃ |
| Kaynama noktası | 397.9°C at 760 mmHg |
| Kırılma indisi | 1.63 |
| Alevlenme noktası | 194.4°C |
| Buhar basıncı | 3.52E-06mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |